C42H78N4O2 — CID 88945231
(9Z,12Z)-N-[(Z)-5-amino-4-(methylamino)-1-[[(Z)-octadec-9-enyl]amino]-1-oxopent-4-en-2-yl]octadeca-9,12-dienamide (PubChem CID 88945231) has the molecular formula C42H78N4O2 and a molecular weight of 671.11 g/mol. Its IUPAC name is (9Z,12Z)-N-[(Z)-5-amino-4-(methylamino)-1-[[(Z)-octadec-9-enyl]amino]-1-oxopent-4-en-2-yl]octadeca-9,12-dienamide.
| Compound Name | (9Z,12Z)-N-[(Z)-5-amino-4-(methylamino)-1-[[(Z)-octadec-9-enyl]amino]-1-oxopent-4-en-2-yl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 88945231 |
| Molecular Formula | C42H78N4O2 |
| Molecular Weight | 671.11 g/mol |
| Exact Mass | 670.61 |
| IUPAC Name | (9Z,12Z)-N-[(Z)-5-amino-4-(methylamino)-1-[[(Z)-octadec-9-enyl]amino]-1-oxopent-4-en-2-yl]octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NC(C/C(=C/N)NC)C(=O)NCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C42H78N4O2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-45-42(48)40(37-39(38-43)44-3)46-41(47)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h13,15,18-21,38,40,44H,4-12,14,16-17,22-37,43H2,1-3H3,(H,45,48)(H,46,47)/b15-13-,20-18-,21-19-,39-38- |
| InChIKey | SHRXPGVDJLFBBX-ITQWJWMZSA-N |
| XLogP | 10.85 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.11 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|