C20H19NO6 — CID 88948972
3-hydroxy-7-piperidin-4-yl-2-(2,4,5-trihydroxyphenyl)chromen-4-one (PubChem CID 88948972) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is 3-hydroxy-7-piperidin-4-yl-2-(2,4,5-trihydroxyphenyl)chromen-4-one.
| Compound Name | 3-hydroxy-7-piperidin-4-yl-2-(2,4,5-trihydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 88948972 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-hydroxy-7-piperidin-4-yl-2-(2,4,5-trihydroxyphenyl)chromen-4-one |
| SMILES | O=c1c(O)c(-c2cc(O)c(O)cc2O)oc2cc(C3CCNCC3)ccc12 |
| InChI | InChI=1S/C20H19NO6/c22-14-9-16(24)15(23)8-13(14)20-19(26)18(25)12-2-1-11(7-17(12)27-20)10-3-5-21-6-4-10/h1-2,7-10,21-24,26H,3-6H2 |
| InChIKey | UXTMSAFSXHLUIK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|