(5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid

C9H19NO3 — CID 88951304

IUPAC(5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid
SMILESCC(C)(CO)CC(C)(C)NC(=O)O
InChIInChI=1S/C9H19NO3/c1-8(2,6-11)5-9(3,4)10-7(12)13/h10-11H,5-6H2,1-4H3,(H,12,13)
InChIKeyQWYSRPPUWRQNNY-UHFFFAOYSA-N
MW189.25 g/mol
LogP1.44
Rot. Bonds4

About (5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid

(5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid (PubChem CID 88951304) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is (5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid.

Molecular Properties

Compound Name(5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid
PubChem CID88951304
Molecular FormulaC9H19NO3
Molecular Weight189.25 g/mol
Exact Mass189.14
IUPAC Name(5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid
SMILESCC(C)(CO)CC(C)(C)NC(=O)O
InChIInChI=1S/C9H19NO3/c1-8(2,6-11)5-9(3,4)10-7(12)13/h10-11H,5-6H2,1-4H3,(H,12,13)
InChIKeyQWYSRPPUWRQNNY-UHFFFAOYSA-N
XLogP1.44
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.25
LogP ≤ 51.44
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze (5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid?
The IUPAC name of (5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid (CID 88951304) is (5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid.
What is the SMILES notation for (5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid?
The canonical SMILES for (5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid is CC(C)(CO)CC(C)(C)NC(=O)O.
What is the InChIKey of (5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid?
The InChIKey is QWYSRPPUWRQNNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3/c1-8(2,6-11)5-9(3,4)10-7(12)13/h10-11H,5-6H2,1-4H3,(H,12,13).
What are the key properties of (5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid?
(5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid has a molecular weight of 189.25 g/mol, XLogP of 1.44, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-hydroxy-2,4,4-trimethylpentan-2-yl)carbamic acid is sourced from PubChem (CID 88951304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).