C19H25N3O3S2 — CID 8895391
N-(4,5-dihydro-1,3-thiazol-2-yl)-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide (PubChem CID 8895391) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 8895391 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide |
| SMILES | O=C(NC1=NCCS1)C1CCN(S(=O)(=O)c2ccc3c(c2)CCCC3)CC1 |
| InChI | InChI=1S/C19H25N3O3S2/c23-18(21-19-20-9-12-26-19)15-7-10-22(11-8-15)27(24,25)17-6-5-14-3-1-2-4-16(14)13-17/h5-6,13,15H,1-4,7-12H2,(H,20,21,23) |
| InChIKey | DAOVVWUOZLPDKS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |