C29H25FN4O7S — CID 88954159
(4S,5S,6R)-4-amino-9-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 88954159) has the molecular formula C29H25FN4O7S and a molecular weight of 592.61 g/mol. Its IUPAC name is (4S,5S,6R)-4-amino-9-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,5S,6R)-4-amino-9-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 88954159 |
| Molecular Formula | C29H25FN4O7S |
| Molecular Weight | 592.61 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | (4S,5S,6R)-4-amino-9-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(Nc3nc(-c4ccc(F)cc4)cs3)c(O)c2C(O)=C2C(=O)C3C(=O)C(C(N)=O)=C(O)[C@@H](N)C3C(O)C21 |
| InChI | InChI=1S/C29H25FN4O7S/c1-9-12-6-7-13(33-29-34-14(8-42-29)10-2-4-11(30)5-3-10)22(35)16(12)24(37)18-15(9)23(36)17-19(25(18)38)26(39)20(28(32)41)27(40)21(17)31/h2-9,15,17,19,21,23,35-37,40H,31H2,1H3,(H2,32,41)(H,33,34)/t9-,15?,17?,19?,21-,23?/m0/s1 |
| InChIKey | UQEUMPHKXJWZFG-ZRPFKQRFSA-N |
| XLogP | 2.78 |
| TPSA | 209.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.61 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|