C11H16N2O3S2 — CID 88954919
1-[(6-ethoxy-3-pyridinyl)sulfonyl]pyrrolidine-3-thiol (PubChem CID 88954919) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-[(6-ethoxy-3-pyridinyl)sulfonyl]pyrrolidine-3-thiol.
| Compound Name | 1-[(6-ethoxy-3-pyridinyl)sulfonyl]pyrrolidine-3-thiol |
|---|---|
| PubChem CID | 88954919 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 1-[(6-ethoxy-3-pyridinyl)sulfonyl]pyrrolidine-3-thiol |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(S)C2)cn1 |
| InChI | InChI=1S/C11H16N2O3S2/c1-2-16-11-4-3-10(7-12-11)18(14,15)13-6-5-9(17)8-13/h3-4,7,9,17H,2,5-6,8H2,1H3 |
| InChIKey | AXUUKUPHPUXYSV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 59.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|