C16H23N5O3S — CID 129333564
(2R)-4-[(6-ethoxy-3-pyridinyl)sulfonyl]-1-ethyl-2-(1H-imidazol-2-yl)piperazine (PubChem CID 129333564) has the molecular formula C16H23N5O3S and a molecular weight of 365.46 g/mol. Its IUPAC name is (2R)-4-[(6-ethoxy-3-pyridinyl)sulfonyl]-1-ethyl-2-(1H-imidazol-2-yl)piperazine.
| Compound Name | (2R)-4-[(6-ethoxy-3-pyridinyl)sulfonyl]-1-ethyl-2-(1H-imidazol-2-yl)piperazine |
|---|---|
| PubChem CID | 129333564 |
| Molecular Formula | C16H23N5O3S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (2R)-4-[(6-ethoxy-3-pyridinyl)sulfonyl]-1-ethyl-2-(1H-imidazol-2-yl)piperazine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(CC)[C@@H](c3ncc[nH]3)C2)cn1 |
| InChI | InChI=1S/C16H23N5O3S/c1-3-20-9-10-21(12-14(20)16-17-7-8-18-16)25(22,23)13-5-6-15(19-11-13)24-4-2/h5-8,11,14H,3-4,9-10,12H2,1-2H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | MNGWSRJEZDYUCT-CQSZACIVSA-N |
| XLogP | 1.27 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |