C15H26N4O3S — CID 129340949
(2S)-1-ethyl-2-(1H-imidazol-2-yl)-4-(oxan-4-ylmethylsulfonyl)piperazine (PubChem CID 129340949) has the molecular formula C15H26N4O3S and a molecular weight of 342.47 g/mol. Its IUPAC name is (2S)-1-ethyl-2-(1H-imidazol-2-yl)-4-(oxan-4-ylmethylsulfonyl)piperazine.
| Compound Name | (2S)-1-ethyl-2-(1H-imidazol-2-yl)-4-(oxan-4-ylmethylsulfonyl)piperazine |
|---|---|
| PubChem CID | 129340949 |
| Molecular Formula | C15H26N4O3S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (2S)-1-ethyl-2-(1H-imidazol-2-yl)-4-(oxan-4-ylmethylsulfonyl)piperazine |
| SMILES | CCN1CCN(S(=O)(=O)CC2CCOCC2)C[C@H]1c1ncc[nH]1 |
| InChI | InChI=1S/C15H26N4O3S/c1-2-18-7-8-19(11-14(18)15-16-5-6-17-15)23(20,21)12-13-3-9-22-10-4-13/h5-6,13-14H,2-4,7-12H2,1H3,(H,16,17)/t14-/m0/s1 |
| InChIKey | YDFGPDCGSFZUEZ-AWEZNQCLSA-N |
| XLogP | 0.84 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |