C16H18ClN5O2S — CID 128997381
2-chloro-5-[4-ethyl-3-(1H-imidazol-2-yl)piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 128997381) has the molecular formula C16H18ClN5O2S and a molecular weight of 379.87 g/mol. Its IUPAC name is 2-chloro-5-[4-ethyl-3-(1H-imidazol-2-yl)piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-chloro-5-[4-ethyl-3-(1H-imidazol-2-yl)piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 128997381 |
| Molecular Formula | C16H18ClN5O2S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2-chloro-5-[4-ethyl-3-(1H-imidazol-2-yl)piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | CCN1CCN(S(=O)(=O)c2ccc(Cl)c(C#N)c2)CC1c1ncc[nH]1 |
| InChI | InChI=1S/C16H18ClN5O2S/c1-2-21-7-8-22(11-15(21)16-19-5-6-20-16)25(23,24)13-3-4-14(17)12(9-13)10-18/h3-6,9,15H,2,7-8,11H2,1H3,(H,19,20) |
| InChIKey | PWVQRSSUXOYGAW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |