C14H24N4O3S — CID 129328989
(2R)-2-(1H-imidazol-2-yl)-1-methyl-4-[[(2S)-oxan-2-yl]methylsulfonyl]piperazine (PubChem CID 129328989) has the molecular formula C14H24N4O3S and a molecular weight of 328.44 g/mol. Its IUPAC name is (2R)-2-(1H-imidazol-2-yl)-1-methyl-4-[[(2S)-oxan-2-yl]methylsulfonyl]piperazine.
| Compound Name | (2R)-2-(1H-imidazol-2-yl)-1-methyl-4-[[(2S)-oxan-2-yl]methylsulfonyl]piperazine |
|---|---|
| PubChem CID | 129328989 |
| Molecular Formula | C14H24N4O3S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2R)-2-(1H-imidazol-2-yl)-1-methyl-4-[[(2S)-oxan-2-yl]methylsulfonyl]piperazine |
| SMILES | CN1CCN(S(=O)(=O)C[C@@H]2CCCCO2)C[C@@H]1c1ncc[nH]1 |
| InChI | InChI=1S/C14H24N4O3S/c1-17-7-8-18(10-13(17)14-15-5-6-16-14)22(19,20)11-12-4-2-3-9-21-12/h5-6,12-13H,2-4,7-11H2,1H3,(H,15,16)/t12-,13+/m0/s1 |
| InChIKey | CYAVVTAHLXNLMT-QWHCGFSZSA-N |
| XLogP | 0.60 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |