C11H12Br2O4 — CID 88955233
methyl 2-[2,5-dibromo-4-(methylperoxymethyl)phenyl]acetate (PubChem CID 88955233) has the molecular formula C11H12Br2O4 and a molecular weight of 368.02 g/mol. Its IUPAC name is methyl 2-[2,5-dibromo-4-(methylperoxymethyl)phenyl]acetate.
| Compound Name | methyl 2-[2,5-dibromo-4-(methylperoxymethyl)phenyl]acetate |
|---|---|
| PubChem CID | 88955233 |
| Molecular Formula | C11H12Br2O4 |
| Molecular Weight | 368.02 g/mol |
| Exact Mass | 365.91 |
| IUPAC Name | methyl 2-[2,5-dibromo-4-(methylperoxymethyl)phenyl]acetate |
| SMILES | COOCc1cc(Br)c(CC(=O)OC)cc1Br |
| InChI | InChI=1S/C11H12Br2O4/c1-15-11(14)5-7-3-10(13)8(4-9(7)12)6-17-16-2/h3-4H,5-6H2,1-2H3 |
| InChIKey | DCRINYVQPQEWFN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.02 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|