About 1-bromo-2-methyl-4,5-bis(methylperoxymethyl)benzene
1-bromo-2-methyl-4,5-bis(methylperoxymethyl)benzene (PubChem CID 21350842) has the molecular formula C11H15BrO4
and a molecular weight of 291.14 g/mol. Its IUPAC name is 1-bromo-2-methyl-4,5-bis(methylperoxymethyl)benzene.
Molecular Properties
| Compound Name | 1-bromo-2-methyl-4,5-bis(methylperoxymethyl)benzene |
| PubChem CID | 21350842 |
| Molecular Formula | C11H15BrO4 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 1-bromo-2-methyl-4,5-bis(methylperoxymethyl)benzene |
| SMILES | COOCc1cc(C)c(Br)cc1COOC |
| InChI | InChI=1S/C11H15BrO4/c1-8-4-9(6-15-13-2)10(5-11(8)12)7-16-14-3/h4-5H,6-7H2,1-3H3 |
| InChIKey | NLBGOBFIPRPZQE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-methyl-4,5-bis(methylperoxymethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-methyl-4,5-bis(methylperoxymethyl)benzene?
The IUPAC name of 1-bromo-2-methyl-4,5-bis(methylperoxymethyl)benzene (CID 21350842) is 1-bromo-2-methyl-4,5-bis(methylperoxymethyl)benzene.
What is the SMILES notation for 1-bromo-2-methyl-4,5-bis(methylperoxymethyl)benzene?
The canonical SMILES for 1-bromo-2-methyl-4,5-bis(methylperoxymethyl)benzene is COOCc1cc(C)c(Br)cc1COOC.
What is the InChIKey of 1-bromo-2-methyl-4,5-bis(methylperoxymethyl)benzene?
The InChIKey is NLBGOBFIPRPZQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrO4/c1-8-4-9(6-15-13-2)10(5-11(8)12)7-16-14-3/h4-5H,6-7H2,1-3H3.
What are the key properties of 1-bromo-2-methyl-4,5-bis(methylperoxymethyl)benzene?
1-bromo-2-methyl-4,5-bis(methylperoxymethyl)benzene has a molecular weight of 291.14 g/mol, XLogP of 2.91, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-methyl-4,5-bis(methylperoxymethyl)benzene is sourced from PubChem (CID 21350842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).