C22H32N2O7 — CID 88956296
1-[1,3-bis(3-oxopropoxy)-2-(3-oxopropoxymethyl)propan-2-yl]-3-[(4-methylphenyl)methyl]urea (PubChem CID 88956296) has the molecular formula C22H32N2O7 and a molecular weight of 436.51 g/mol. Its IUPAC name is 1-[1,3-bis(3-oxopropoxy)-2-(3-oxopropoxymethyl)propan-2-yl]-3-[(4-methylphenyl)methyl]urea.
| Compound Name | 1-[1,3-bis(3-oxopropoxy)-2-(3-oxopropoxymethyl)propan-2-yl]-3-[(4-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 88956296 |
| Molecular Formula | C22H32N2O7 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 1-[1,3-bis(3-oxopropoxy)-2-(3-oxopropoxymethyl)propan-2-yl]-3-[(4-methylphenyl)methyl]urea |
| SMILES | Cc1ccc(CNC(=O)NC(COCCC=O)(COCCC=O)COCCC=O)cc1 |
| InChI | InChI=1S/C22H32N2O7/c1-19-5-7-20(8-6-19)15-23-21(28)24-22(16-29-12-2-9-25,17-30-13-3-10-26)18-31-14-4-11-27/h5-11H,2-4,12-18H2,1H3,(H2,23,24,28) |
| InChIKey | BMINWGVISFLPAA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|