C27H14F8O5S — CID 88956826
[2,3,5,6-tetrafluoro-4-[4-(4-methoxyphenyl)sulfonylphenoxy]phenyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)methanone (PubChem CID 88956826) has the molecular formula C27H14F8O5S and a molecular weight of 602.46 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-[4-(4-methoxyphenyl)sulfonylphenoxy]phenyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)methanone.
| Compound Name | [2,3,5,6-tetrafluoro-4-[4-(4-methoxyphenyl)sulfonylphenoxy]phenyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)methanone |
|---|---|
| PubChem CID | 88956826 |
| Molecular Formula | C27H14F8O5S |
| Molecular Weight | 602.46 g/mol |
| Exact Mass | 602.04 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-[4-(4-methoxyphenyl)sulfonylphenoxy]phenyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)methanone |
| SMILES | COc1ccc(S(=O)(=O)c2ccc(Oc3c(F)c(F)c(C(=O)c4c(F)c(F)c(C)c(F)c4F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C27H14F8O5S/c1-11-18(28)20(30)16(21(31)19(11)29)26(36)17-22(32)24(34)27(25(35)23(17)33)40-13-5-9-15(10-6-13)41(37,38)14-7-3-12(39-2)4-8-14/h3-10H,1-2H3 |
| InChIKey | TWYCRNXXAGAJSN-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.46 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|