C18H20F3N3O4S2 — CID 88961653
2,2-dimethylpropyl [3-[4-cyano-3-(trifluoromethyl)phenyl]-5-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]methanesulfonate (PubChem CID 88961653) has the molecular formula C18H20F3N3O4S2 and a molecular weight of 463.50 g/mol. Its IUPAC name is 2,2-dimethylpropyl [3-[4-cyano-3-(trifluoromethyl)phenyl]-5-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]methanesulfonate.
| Compound Name | 2,2-dimethylpropyl [3-[4-cyano-3-(trifluoromethyl)phenyl]-5-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]methanesulfonate |
|---|---|
| PubChem CID | 88961653 |
| Molecular Formula | C18H20F3N3O4S2 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 2,2-dimethylpropyl [3-[4-cyano-3-(trifluoromethyl)phenyl]-5-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]methanesulfonate |
| SMILES | CC1C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N1CS(=O)(=O)OCC(C)(C)C |
| InChI | InChI=1S/C18H20F3N3O4S2/c1-11-15(25)24(13-6-5-12(8-22)14(7-13)18(19,20)21)16(29)23(11)10-30(26,27)28-9-17(2,3)4/h5-7,11H,9-10H2,1-4H3 |
| InChIKey | IXRQSHAWDNWRKJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|