C24H26F3IN2O — CID 88962063
N-[(1-benzylpiperidin-4-yl)methyl]-2,2,2-trifluoro-N-[2-(4-iodophenyl)cyclopropyl]acetamide (PubChem CID 88962063) has the molecular formula C24H26F3IN2O and a molecular weight of 542.38 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-yl)methyl]-2,2,2-trifluoro-N-[2-(4-iodophenyl)cyclopropyl]acetamide.
| Compound Name | N-[(1-benzylpiperidin-4-yl)methyl]-2,2,2-trifluoro-N-[2-(4-iodophenyl)cyclopropyl]acetamide |
|---|---|
| PubChem CID | 88962063 |
| Molecular Formula | C24H26F3IN2O |
| Molecular Weight | 542.38 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | N-[(1-benzylpiperidin-4-yl)methyl]-2,2,2-trifluoro-N-[2-(4-iodophenyl)cyclopropyl]acetamide |
| SMILES | O=C(N(CC1CCN(Cc2ccccc2)CC1)C1CC1c1ccc(I)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H26F3IN2O/c25-24(26,27)23(31)30(22-14-21(22)19-6-8-20(28)9-7-19)16-18-10-12-29(13-11-18)15-17-4-2-1-3-5-17/h1-9,18,21-22H,10-16H2 |
| InChIKey | OBHAIPJNOUFLSC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.38 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|