C23H21F3N8O2S — CID 88966670
1-ethyl-3-[(6R)-7,8,8-trifluoro-6-propan-2-yl-25-oxa-11-thia-3,4,7,16,21,24-hexazapentacyclo[17.3.1.12,5.19,12.013,18]pentacosa-1(22),2,4,9,12(24),13,15,17,19(23),20-decaen-15-yl]urea (PubChem CID 88966670) has the molecular formula C23H21F3N8O2S and a molecular weight of 530.54 g/mol. Its IUPAC name is 1-ethyl-3-[(6R)-7,8,8-trifluoro-6-propan-2-yl-25-oxa-11-thia-3,4,7,16,21,24-hexazapentacyclo[17.3.1.12,5.19,12.013,18]pentacosa-1(22),2,4,9,12(24),13,15,17,19(23),20-decaen-15-yl]urea.
| Compound Name | 1-ethyl-3-[(6R)-7,8,8-trifluoro-6-propan-2-yl-25-oxa-11-thia-3,4,7,16,21,24-hexazapentacyclo[17.3.1.12,5.19,12.013,18]pentacosa-1(22),2,4,9,12(24),13,15,17,19(23),20-decaen-15-yl]urea |
|---|---|
| PubChem CID | 88966670 |
| Molecular Formula | C23H21F3N8O2S |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 1-ethyl-3-[(6R)-7,8,8-trifluoro-6-propan-2-yl-25-oxa-11-thia-3,4,7,16,21,24-hexazapentacyclo[17.3.1.12,5.19,12.013,18]pentacosa-1(22),2,4,9,12(24),13,15,17,19(23),20-decaen-15-yl]urea |
| SMILES | CCNC(=O)Nc1cc2c(cn1)-c1cncc(c1)-c1nnc(o1)[C@@H](C(C)C)N(F)C(F)(F)c1csc-2n1 |
| InChI | InChI=1S/C23H21F3N8O2S/c1-4-28-22(35)31-17-6-14-15(9-29-17)12-5-13(8-27-7-12)19-32-33-20(36-19)18(11(2)3)34(26)23(24,25)16-10-37-21(14)30-16/h5-11,18H,4H2,1-3H3,(H2,28,29,31,35)/t18-/m1/s1 |
| InChIKey | AVMRHANQRIMSRU-GOSISDBHSA-N |
| XLogP | 5.41 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|