C8H12ClF3N4O — CID 88968472
2-chloro-N-[2-[[(E)-1,3-diamino-2-(trifluoromethyl)prop-2-enylidene]amino]ethyl]acetamide (PubChem CID 88968472) has the molecular formula C8H12ClF3N4O and a molecular weight of 272.66 g/mol. Its IUPAC name is 2-chloro-N-[2-[[(E)-1,3-diamino-2-(trifluoromethyl)prop-2-enylidene]amino]ethyl]acetamide.
| Compound Name | 2-chloro-N-[2-[[(E)-1,3-diamino-2-(trifluoromethyl)prop-2-enylidene]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 88968472 |
| Molecular Formula | C8H12ClF3N4O |
| Molecular Weight | 272.66 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-chloro-N-[2-[[(E)-1,3-diamino-2-(trifluoromethyl)prop-2-enylidene]amino]ethyl]acetamide |
| SMILES | N/C=C(C(\N)=N\CCNC(=O)CCl)/C(F)(F)F |
| InChI | InChI=1S/C8H12ClF3N4O/c9-3-6(17)15-1-2-16-7(14)5(4-13)8(10,11)12/h4H,1-3,13H2,(H2,14,16)(H,15,17)/b5-4+ |
| InChIKey | RJRVVKDBJRHSIZ-SNAWJCMRSA-N |
| XLogP | 0.10 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.66 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|