About CID 88970975
CID 88970975 (PubChem CID 88970975) has the molecular formula C42H30BN
and a molecular weight of 559.52 g/mol.
Molecular Properties
| Compound Name | CID 88970975 |
| PubChem CID | 88970975 |
| Molecular Formula | C42H30BN |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N(c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c2cc(-c3ccccc3)cc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C42H30BN/c43-39-21-23-40(24-22-39)44(41-27-35(31-13-5-1-6-14-31)25-36(28-41)32-15-7-2-8-16-32)42-29-37(33-17-9-3-10-18-33)26-38(30-42)34-19-11-4-12-20-34/h1-30H |
| InChIKey | XGJWBWMUMJASLY-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88970975 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88970975?
The IUPAC name of CID 88970975 (CID 88970975) is not available.
What is the SMILES notation for CID 88970975?
The canonical SMILES for CID 88970975 is [B]c1ccc(N(c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c2cc(-c3ccccc3)cc(-c3ccccc3)c2)cc1.
What is the InChIKey of CID 88970975?
The InChIKey is XGJWBWMUMJASLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H30BN/c43-39-21-23-40(24-22-39)44(41-27-35(31-13-5-1-6-14-31)25-36(28-41)32-15-7-2-8-16-32)42-29-37(33-17-9-3-10-18-33)26-38(30-42)34-19-11-4-12-20-34/h1-30H.
What are the key properties of CID 88970975?
CID 88970975 has a molecular weight of 559.52 g/mol, XLogP of 10.62, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88970975 is sourced from PubChem (CID 88970975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).