C42H30BN — CID 88970975
CID 88970975 (PubChem CID 88970975) has the molecular formula C42H30BN and a molecular weight of 559.52 g/mol.
| Compound Name | CID 88970975 |
|---|---|
| PubChem CID | 88970975 |
| Molecular Formula | C42H30BN |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N(c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c2cc(-c3ccccc3)cc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C42H30BN/c43-39-21-23-40(24-22-39)44(41-27-35(31-13-5-1-6-14-31)25-36(28-41)32-15-7-2-8-16-32)42-29-37(33-17-9-3-10-18-33)26-38(30-42)34-19-11-4-12-20-34/h1-30H |
| InChIKey | XGJWBWMUMJASLY-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|