C18H13B2N — CID 89263923
CID 89263923 (PubChem CID 89263923) has the molecular formula C18H13B2N and a molecular weight of 264.93 g/mol.
| Compound Name | CID 89263923 |
|---|---|
| PubChem CID | 89263923 |
| Molecular Formula | C18H13B2N |
| Molecular Weight | 264.93 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N(c2ccccc2)c2ccc([B])cc2)cc1 |
| InChI | InChI=1S/C18H13B2N/c19-14-6-10-17(11-7-14)21(16-4-2-1-3-5-16)18-12-8-15(20)9-13-18/h1-13H |
| InChIKey | LJWHXUCJGLMJQB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.93 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|