C11H12FNO3S — CID 88973623
5-fluoro-N,N-dimethyl-2-[(E)-3-oxoprop-1-enyl]benzenesulfonamide (PubChem CID 88973623) has the molecular formula C11H12FNO3S and a molecular weight of 257.29 g/mol. Its IUPAC name is 5-fluoro-N,N-dimethyl-2-[(E)-3-oxoprop-1-enyl]benzenesulfonamide.
| Compound Name | 5-fluoro-N,N-dimethyl-2-[(E)-3-oxoprop-1-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 88973623 |
| Molecular Formula | C11H12FNO3S |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 5-fluoro-N,N-dimethyl-2-[(E)-3-oxoprop-1-enyl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc(F)ccc1/C=C/C=O |
| InChI | InChI=1S/C11H12FNO3S/c1-13(2)17(15,16)11-8-10(12)6-5-9(11)4-3-7-14/h3-8H,1-2H3/b4-3+ |
| InChIKey | GFOQZACKLWAAOQ-ONEGZZNKSA-N |
| XLogP | 1.29 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|