C9H10FNO3S — CID 11831261
2-fluoro-5-formyl-N,N-dimethylbenzenesulfonamide (PubChem CID 11831261) has the molecular formula C9H10FNO3S and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-fluoro-5-formyl-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-fluoro-5-formyl-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 11831261 |
| Molecular Formula | C9H10FNO3S |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 2-fluoro-5-formyl-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C=O)ccc1F |
| InChI | InChI=1S/C9H10FNO3S/c1-11(2)15(13,14)9-5-7(6-12)3-4-8(9)10/h3-6H,1-2H3 |
| InChIKey | UIHNZHVGAYTTPY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|