C14H13FN2O5S2 — CID 123474330
N-[1-[(2-fluoro-5-formylphenyl)sulfonylamino]ethyl]-3-hydroxythiophene-2-carboxamide (PubChem CID 123474330) has the molecular formula C14H13FN2O5S2 and a molecular weight of 372.40 g/mol. Its IUPAC name is N-[1-[(2-fluoro-5-formylphenyl)sulfonylamino]ethyl]-3-hydroxythiophene-2-carboxamide.
| Compound Name | N-[1-[(2-fluoro-5-formylphenyl)sulfonylamino]ethyl]-3-hydroxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 123474330 |
| Molecular Formula | C14H13FN2O5S2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | N-[1-[(2-fluoro-5-formylphenyl)sulfonylamino]ethyl]-3-hydroxythiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1sccc1O)NS(=O)(=O)c1cc(C=O)ccc1F |
| InChI | InChI=1S/C14H13FN2O5S2/c1-8(16-14(20)13-11(19)4-5-23-13)17-24(21,22)12-6-9(7-18)2-3-10(12)15/h2-8,17,19H,1H3,(H,16,20) |
| InChIKey | OTDXBUFFFLAUNV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|