C10H13FOS — CID 130642481
1-(3-fluorothiophen-2-yl)-2,3-dimethylbutan-1-one (PubChem CID 130642481) has the molecular formula C10H13FOS and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-(3-fluorothiophen-2-yl)-2,3-dimethylbutan-1-one.
| Compound Name | 1-(3-fluorothiophen-2-yl)-2,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 130642481 |
| Molecular Formula | C10H13FOS |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 1-(3-fluorothiophen-2-yl)-2,3-dimethylbutan-1-one |
| SMILES | CC(C)C(C)C(=O)c1sccc1F |
| InChI | InChI=1S/C10H13FOS/c1-6(2)7(3)9(12)10-8(11)4-5-13-10/h4-7H,1-3H3 |
| InChIKey | LIKZJNGBBZDPSY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |