C8H7FO2S — CID 174590149
1-(3-fluorothiophen-2-yl)butane-1,3-dione (PubChem CID 174590149) has the molecular formula C8H7FO2S and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-(3-fluorothiophen-2-yl)butane-1,3-dione.
| Compound Name | 1-(3-fluorothiophen-2-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 174590149 |
| Molecular Formula | C8H7FO2S |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | 1-(3-fluorothiophen-2-yl)butane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1sccc1F |
| InChI | InChI=1S/C8H7FO2S/c1-5(10)4-7(11)8-6(9)2-3-12-8/h2-3H,4H2,1H3 |
| InChIKey | SASGORJIFWSTGJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|