C18H29N3O5S — CID 88974567
N-(4-butoxy-2-nitrosophenyl)-5-(propan-2-ylsulfonylamino)pentanamide (PubChem CID 88974567) has the molecular formula C18H29N3O5S and a molecular weight of 399.51 g/mol. Its IUPAC name is N-(4-butoxy-2-nitrosophenyl)-5-(propan-2-ylsulfonylamino)pentanamide.
| Compound Name | N-(4-butoxy-2-nitrosophenyl)-5-(propan-2-ylsulfonylamino)pentanamide |
|---|---|
| PubChem CID | 88974567 |
| Molecular Formula | C18H29N3O5S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-(4-butoxy-2-nitrosophenyl)-5-(propan-2-ylsulfonylamino)pentanamide |
| SMILES | CCCCOc1ccc(NC(=O)CCCCNS(=O)(=O)C(C)C)c(N=O)c1 |
| InChI | InChI=1S/C18H29N3O5S/c1-4-5-12-26-15-9-10-16(17(13-15)21-23)20-18(22)8-6-7-11-19-27(24,25)14(2)3/h9-10,13-14,19H,4-8,11-12H2,1-3H3,(H,20,22) |
| InChIKey | LEULWZLNIIYSKJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|