C12H14FNO — CID 88975713
(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carbaldehyde (PubChem CID 88975713) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is (2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carbaldehyde.
| Compound Name | (2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 88975713 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | (2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carbaldehyde |
| SMILES | O=C[C@@H]1C[C@H](Cc2cccc(F)c2)CN1 |
| InChI | InChI=1S/C12H14FNO/c13-11-3-1-2-9(5-11)4-10-6-12(8-15)14-7-10/h1-3,5,8,10,12,14H,4,6-7H2/t10-,12-/m0/s1 |
| InChIKey | VSGYSEFNZLPLDR-JQWIXIFHSA-N |
| XLogP | 1.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|