C26H24BFN4O3 — CID 88975999
CID 88975999 (PubChem CID 88975999) has the molecular formula C26H24BFN4O3 and a molecular weight of 470.31 g/mol.
| Compound Name | CID 88975999 |
|---|---|
| PubChem CID | 88975999 |
| Molecular Formula | C26H24BFN4O3 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(F)cc1C(=O)N1CCN(C(=O)CNC(=O)c2ccc(Nc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C26H24BFN4O3/c27-23-11-8-19(28)16-22(23)26(35)32-14-12-31(13-15-32)24(33)17-29-25(34)18-6-9-21(10-7-18)30-20-4-2-1-3-5-20/h1-11,16,30H,12-15,17H2,(H,29,34) |
| InChIKey | OATWGKBGHYOQDN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|