C38H40FN5O3 — CID 88976469
3-cyclopentyl-N-[1-[6-ethoxy-1-methyl-5-[(E)-3-oxobut-1-enyl]benzimidazol-2-yl]cyclobutyl]-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carboxamide (PubChem CID 88976469) has the molecular formula C38H40FN5O3 and a molecular weight of 633.77 g/mol. Its IUPAC name is 3-cyclopentyl-N-[1-[6-ethoxy-1-methyl-5-[(E)-3-oxobut-1-enyl]benzimidazol-2-yl]cyclobutyl]-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carboxamide.
| Compound Name | 3-cyclopentyl-N-[1-[6-ethoxy-1-methyl-5-[(E)-3-oxobut-1-enyl]benzimidazol-2-yl]cyclobutyl]-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carboxamide |
|---|---|
| PubChem CID | 88976469 |
| Molecular Formula | C38H40FN5O3 |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.31 |
| IUPAC Name | 3-cyclopentyl-N-[1-[6-ethoxy-1-methyl-5-[(E)-3-oxobut-1-enyl]benzimidazol-2-yl]cyclobutyl]-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carboxamide |
| SMILES | CCOc1cc2c(cc1/C=C/C(C)=O)nc(C1(NC(=O)c3ccc4c(C5CCCC5)c(-c5ccc(F)cn5)n(C)c4c3)CCC1)n2C |
| InChI | InChI=1S/C38H40FN5O3/c1-5-47-33-21-32-30(19-25(33)12-11-23(2)45)41-37(44(32)4)38(17-8-18-38)42-36(46)26-13-15-28-31(20-26)43(3)35(29-16-14-27(39)22-40-29)34(28)24-9-6-7-10-24/h11-16,19-22,24H,5-10,17-18H2,1-4H3,(H,42,46)/b12-11+ |
| InChIKey | VMYLHSOGLKWSMA-VAWYXSNFSA-N |
| XLogP | 7.73 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|