C36H37FN4O5 — CID 11643037
(E)-3-[4-[[1-[[3-cyclopentyl-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]-2-ethoxyphenyl]prop-2-enoic acid (PubChem CID 11643037) has the molecular formula C36H37FN4O5 and a molecular weight of 624.71 g/mol. Its IUPAC name is (E)-3-[4-[[1-[[3-cyclopentyl-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]-2-ethoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[[3-cyclopentyl-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]-2-ethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11643037 |
| Molecular Formula | C36H37FN4O5 |
| Molecular Weight | 624.71 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | (E)-3-[4-[[1-[[3-cyclopentyl-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]-2-ethoxyphenyl]prop-2-enoic acid |
| SMILES | CCOc1cc(NC(=O)C2(NC(=O)c3ccc4c(C5CCCC5)c(-c5ccc(F)cn5)n(C)c4c3)CCC2)ccc1/C=C/C(=O)O |
| InChI | InChI=1S/C36H37FN4O5/c1-3-46-30-20-26(13-9-22(30)11-16-31(42)43)39-35(45)36(17-6-18-36)40-34(44)24-10-14-27-29(19-24)41(2)33(28-15-12-25(37)21-38-28)32(27)23-7-4-5-8-23/h9-16,19-21,23H,3-8,17-18H2,1-2H3,(H,39,45)(H,40,44)(H,42,43)/b16-11+ |
| InChIKey | SMFGDGDMFXLDCU-LFIBNONCSA-N |
| XLogP | 6.82 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.71 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|