About 3,3-difluoro-1,8-diazaspiro[3.5]nonane
3,3-difluoro-1,8-diazaspiro[3.5]nonane (PubChem CID 88978072) has the molecular formula C7H12F2N2
and a molecular weight of 162.18 g/mol. Its IUPAC name is 3,3-difluoro-1,8-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 3,3-difluoro-1,8-diazaspiro[3.5]nonane |
| PubChem CID | 88978072 |
| Molecular Formula | C7H12F2N2 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 3,3-difluoro-1,8-diazaspiro[3.5]nonane |
| SMILES | FC1(F)CNC12CCCNC2 |
| InChI | InChI=1S/C7H12F2N2/c8-7(9)5-11-6(7)2-1-3-10-4-6/h10-11H,1-5H2 |
| InChIKey | QWTNBYACFCVKGU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-difluoro-1,8-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-1,8-diazaspiro[3.5]nonane?
The IUPAC name of 3,3-difluoro-1,8-diazaspiro[3.5]nonane (CID 88978072) is 3,3-difluoro-1,8-diazaspiro[3.5]nonane.
What is the SMILES notation for 3,3-difluoro-1,8-diazaspiro[3.5]nonane?
The canonical SMILES for 3,3-difluoro-1,8-diazaspiro[3.5]nonane is FC1(F)CNC12CCCNC2.
What is the InChIKey of 3,3-difluoro-1,8-diazaspiro[3.5]nonane?
The InChIKey is QWTNBYACFCVKGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F2N2/c8-7(9)5-11-6(7)2-1-3-10-4-6/h10-11H,1-5H2.
What are the key properties of 3,3-difluoro-1,8-diazaspiro[3.5]nonane?
3,3-difluoro-1,8-diazaspiro[3.5]nonane has a molecular weight of 162.18 g/mol, XLogP of 0.35, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-1,8-diazaspiro[3.5]nonane is sourced from PubChem (CID 88978072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).