C18H16BFN4O2 — CID 88978617
CID 88978617 (PubChem CID 88978617) has the molecular formula C18H16BFN4O2 and a molecular weight of 350.16 g/mol.
| Compound Name | CID 88978617 |
|---|---|
| PubChem CID | 88978617 |
| Molecular Formula | C18H16BFN4O2 |
| Molecular Weight | 350.16 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(N)C(=O)Nc2cc(OC)c(-c3cn[nH]c3)cc2F)cc1 |
| InChI | InChI=1S/C18H16BFN4O2/c1-26-16-7-15(14(20)6-13(16)11-8-22-23-9-11)24-18(25)17(21)10-2-4-12(19)5-3-10/h2-9,17H,21H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | QNMOISSHXLQBMW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.16 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|