C14H31NO7S2 — CID 88980989
[(2S)-3-[tert-butyl(methylsulfonyl)amino]-2-[(2S)-3,3-dimethylbutan-2-yl]oxypropyl] hydrogen sulfate (PubChem CID 88980989) has the molecular formula C14H31NO7S2 and a molecular weight of 389.54 g/mol. Its IUPAC name is [(2S)-3-[tert-butyl(methylsulfonyl)amino]-2-[(2S)-3,3-dimethylbutan-2-yl]oxypropyl] hydrogen sulfate.
| Compound Name | [(2S)-3-[tert-butyl(methylsulfonyl)amino]-2-[(2S)-3,3-dimethylbutan-2-yl]oxypropyl] hydrogen sulfate |
|---|---|
| PubChem CID | 88980989 |
| Molecular Formula | C14H31NO7S2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | [(2S)-3-[tert-butyl(methylsulfonyl)amino]-2-[(2S)-3,3-dimethylbutan-2-yl]oxypropyl] hydrogen sulfate |
| SMILES | C[C@H](O[C@H](COS(=O)(=O)O)CN(C(C)(C)C)S(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C14H31NO7S2/c1-11(13(2,3)4)22-12(10-21-24(18,19)20)9-15(14(5,6)7)23(8,16)17/h11-12H,9-10H2,1-8H3,(H,18,19,20)/t11-,12-/m0/s1 |
| InChIKey | JNBANMOXRNZIMA-RYUDHWBXSA-N |
| XLogP | 1.69 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|