C24H21BN6OS — CID 88984131
CID 88984131 (PubChem CID 88984131) has the molecular formula C24H21BN6OS and a molecular weight of 452.35 g/mol.
| Compound Name | CID 88984131 |
|---|---|
| PubChem CID | 88984131 |
| Molecular Formula | C24H21BN6OS |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2nc(C)c(-c3nc(-c4ccccc4)c(-c4ncn(C5CCCCO5)n4)s3)n2c1 |
| InChI | InChI=1S/C24H21BN6OS/c1-15-21(30-13-17(25)10-11-18(30)27-15)24-28-20(16-7-3-2-4-8-16)22(33-24)23-26-14-31(29-23)19-9-5-6-12-32-19/h2-4,7-8,10-11,13-14,19H,5-6,9,12H2,1H3 |
| InChIKey | ZFYHHFNHJCFYEN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|