C25H26N6S — CID 161012942
5-[3-[5-(1H-imidazol-2-yl)-4-phenyl-1,3-thiazol-2-yl]-2-methylimidazo[1,2-a]pyridin-6-yl]pentan-1-amine (PubChem CID 161012942) has the molecular formula C25H26N6S and a molecular weight of 442.59 g/mol. Its IUPAC name is 5-[3-[5-(1H-imidazol-2-yl)-4-phenyl-1,3-thiazol-2-yl]-2-methylimidazo[1,2-a]pyridin-6-yl]pentan-1-amine.
| Compound Name | 5-[3-[5-(1H-imidazol-2-yl)-4-phenyl-1,3-thiazol-2-yl]-2-methylimidazo[1,2-a]pyridin-6-yl]pentan-1-amine |
|---|---|
| PubChem CID | 161012942 |
| Molecular Formula | C25H26N6S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 5-[3-[5-(1H-imidazol-2-yl)-4-phenyl-1,3-thiazol-2-yl]-2-methylimidazo[1,2-a]pyridin-6-yl]pentan-1-amine |
| SMILES | Cc1nc2ccc(CCCCCN)cn2c1-c1nc(-c2ccccc2)c(-c2ncc[nH]2)s1 |
| InChI | InChI=1S/C25H26N6S/c1-17-22(31-16-18(8-4-3-7-13-26)11-12-20(31)29-17)25-30-21(19-9-5-2-6-10-19)23(32-25)24-27-14-15-28-24/h2,5-6,9-12,14-16H,3-4,7-8,13,26H2,1H3,(H,27,28) |
| InChIKey | BFFWSPWDIWHYPQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|