C22H24N8S — CID 91044398
2-[6-[(2-aminoethylamino)methyl]-2-methylimidazo[1,2-a]pyridin-3-yl]-N'-methanimidoyl-4-phenyl-1,3-thiazole-5-carboximidamide (PubChem CID 91044398) has the molecular formula C22H24N8S and a molecular weight of 432.56 g/mol. Its IUPAC name is 2-[6-[(2-aminoethylamino)methyl]-2-methylimidazo[1,2-a]pyridin-3-yl]-N'-methanimidoyl-4-phenyl-1,3-thiazole-5-carboximidamide.
| Compound Name | 2-[6-[(2-aminoethylamino)methyl]-2-methylimidazo[1,2-a]pyridin-3-yl]-N'-methanimidoyl-4-phenyl-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 91044398 |
| Molecular Formula | C22H24N8S |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 2-[6-[(2-aminoethylamino)methyl]-2-methylimidazo[1,2-a]pyridin-3-yl]-N'-methanimidoyl-4-phenyl-1,3-thiazole-5-carboximidamide |
| SMILES | [H]/N=C/N=C(\N)c1sc(-c2c(C)nc3ccc(CNCCN)cn23)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H24N8S/c1-14-19(30-12-15(11-26-10-9-23)7-8-17(30)28-14)22-29-18(16-5-3-2-4-6-16)20(31-22)21(25)27-13-24/h2-8,12-13,26H,9-11,23H2,1H3,(H3,24,25,27) |
| InChIKey | JGSVKIFVAZSRDJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|