C20H18N6OS — CID 90720203
N'-methanimidoyl-2-(2-methylpyrazolo[1,5-a]pyridin-3-yl)-4-phenylmethoxy-1,3-thiazole-5-carboximidamide (PubChem CID 90720203) has the molecular formula C20H18N6OS and a molecular weight of 390.47 g/mol. Its IUPAC name is N'-methanimidoyl-2-(2-methylpyrazolo[1,5-a]pyridin-3-yl)-4-phenylmethoxy-1,3-thiazole-5-carboximidamide.
| Compound Name | N'-methanimidoyl-2-(2-methylpyrazolo[1,5-a]pyridin-3-yl)-4-phenylmethoxy-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 90720203 |
| Molecular Formula | C20H18N6OS |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N'-methanimidoyl-2-(2-methylpyrazolo[1,5-a]pyridin-3-yl)-4-phenylmethoxy-1,3-thiazole-5-carboximidamide |
| SMILES | [H]/N=C/N=C(\N)c1sc(-c2c(C)nn3ccccc23)nc1OCc1ccccc1 |
| InChI | InChI=1S/C20H18N6OS/c1-13-16(15-9-5-6-10-26(15)25-13)20-24-19(17(28-20)18(22)23-12-21)27-11-14-7-3-2-4-8-14/h2-10,12H,11H2,1H3,(H3,21,22,23) |
| InChIKey | FMQHLVIQQYRJHB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|