C19H16N6OS — CID 136659889
N'-methanimidoyl-2-(2-methyl-5-oxo-1H-pyrazolo[1,5-a]pyridin-3-yl)-4-phenyl-1,3-thiazole-5-carboximidamide (PubChem CID 136659889) has the molecular formula C19H16N6OS and a molecular weight of 376.45 g/mol. Its IUPAC name is N'-methanimidoyl-2-(2-methyl-5-oxo-1H-pyrazolo[1,5-a]pyridin-3-yl)-4-phenyl-1,3-thiazole-5-carboximidamide.
| Compound Name | N'-methanimidoyl-2-(2-methyl-5-oxo-1H-pyrazolo[1,5-a]pyridin-3-yl)-4-phenyl-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 136659889 |
| Molecular Formula | C19H16N6OS |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N'-methanimidoyl-2-(2-methyl-5-oxo-1H-pyrazolo[1,5-a]pyridin-3-yl)-4-phenyl-1,3-thiazole-5-carboximidamide |
| SMILES | [H]/N=C/N=C(\N)c1sc(-c2c(C)[nH]n3ccc(=O)cc23)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H16N6OS/c1-11-15(14-9-13(26)7-8-25(14)24-11)19-23-16(12-5-3-2-4-6-12)17(27-19)18(21)22-10-20/h2-10,24H,1H3,(H3,20,21,22) |
| InChIKey | IWPINFYFSQXYNP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|