C7H8O3 — CID 88984349
(1S,3S,6R)-7-oxabicyclo[4.1.0]hept-4-ene-3-carboxylic acid (PubChem CID 88984349) has the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. Its IUPAC name is (1S,3S,6R)-7-oxabicyclo[4.1.0]hept-4-ene-3-carboxylic acid.
| Compound Name | (1S,3S,6R)-7-oxabicyclo[4.1.0]hept-4-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 88984349 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | (1S,3S,6R)-7-oxabicyclo[4.1.0]hept-4-ene-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C=C[C@H]2O[C@H]2C1 |
| InChI | InChI=1S/C7H8O3/c8-7(9)4-1-2-5-6(3-4)10-5/h1-2,4-6H,3H2,(H,8,9)/t4-,5-,6+/m1/s1 |
| InChIKey | XQGIYZSRWIYBRO-PBXRRBTRSA-N |
| XLogP | 0.41 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|