C56H28F4N6 — CID 88985069
3-[2-(4-cyano-N-[6-(4-cyano-N-[2-(3-cyanophenyl)-4,6-difluorophenyl]anilino)pyren-1-yl]anilino)-3,5-difluorophenyl]benzonitrile (PubChem CID 88985069) has the molecular formula C56H28F4N6 and a molecular weight of 860.87 g/mol. Its IUPAC name is 3-[2-(4-cyano-N-[6-(4-cyano-N-[2-(3-cyanophenyl)-4,6-difluorophenyl]anilino)pyren-1-yl]anilino)-3,5-difluorophenyl]benzonitrile.
| Compound Name | 3-[2-(4-cyano-N-[6-(4-cyano-N-[2-(3-cyanophenyl)-4,6-difluorophenyl]anilino)pyren-1-yl]anilino)-3,5-difluorophenyl]benzonitrile |
|---|---|
| PubChem CID | 88985069 |
| Molecular Formula | C56H28F4N6 |
| Molecular Weight | 860.87 g/mol |
| Exact Mass | 860.23 |
| IUPAC Name | 3-[2-(4-cyano-N-[6-(4-cyano-N-[2-(3-cyanophenyl)-4,6-difluorophenyl]anilino)pyren-1-yl]anilino)-3,5-difluorophenyl]benzonitrile |
| SMILES | N#Cc1ccc(N(c2c(F)cc(F)cc2-c2cccc(C#N)c2)c2ccc3ccc4c(N(c5ccc(C#N)cc5)c5c(F)cc(F)cc5-c5cccc(C#N)c5)ccc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C56H28F4N6/c57-41-25-47(39-5-1-3-35(23-39)31-63)55(49(59)27-41)65(43-15-7-33(29-61)8-16-43)51-21-13-37-12-20-46-52(22-14-38-11-19-45(51)53(37)54(38)46)66(44-17-9-34(30-62)10-18-44)56-48(26-42(58)28-50(56)60)40-6-2-4-36(24-40)32-64/h1-28H |
| InChIKey | WQACPFGOQDBGAK-UHFFFAOYSA-N |
| XLogP | 14.90 |
| TPSA | 101.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.87 |
| LogP ≤ 5 | 14.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|