C56H34F4N4 — CID 88985122
4-[N-[6-(4-cyano-N-[2,4-difluoro-6-(4-methylphenyl)phenyl]anilino)pyren-1-yl]-2,4-difluoro-6-(4-methylphenyl)anilino]benzonitrile (PubChem CID 88985122) has the molecular formula C56H34F4N4 and a molecular weight of 838.91 g/mol. Its IUPAC name is 4-[N-[6-(4-cyano-N-[2,4-difluoro-6-(4-methylphenyl)phenyl]anilino)pyren-1-yl]-2,4-difluoro-6-(4-methylphenyl)anilino]benzonitrile.
| Compound Name | 4-[N-[6-(4-cyano-N-[2,4-difluoro-6-(4-methylphenyl)phenyl]anilino)pyren-1-yl]-2,4-difluoro-6-(4-methylphenyl)anilino]benzonitrile |
|---|---|
| PubChem CID | 88985122 |
| Molecular Formula | C56H34F4N4 |
| Molecular Weight | 838.91 g/mol |
| Exact Mass | 838.27 |
| IUPAC Name | 4-[N-[6-(4-cyano-N-[2,4-difluoro-6-(4-methylphenyl)phenyl]anilino)pyren-1-yl]-2,4-difluoro-6-(4-methylphenyl)anilino]benzonitrile |
| SMILES | Cc1ccc(-c2cc(F)cc(F)c2N(c2ccc(C#N)cc2)c2ccc3ccc4c(N(c5ccc(C#N)cc5)c5c(F)cc(F)cc5-c5ccc(C)cc5)ccc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C56H34F4N4/c1-33-3-11-37(12-4-33)47-27-41(57)29-49(59)55(47)63(43-19-7-35(31-61)8-20-43)51-25-17-39-16-24-46-52(26-18-40-15-23-45(51)53(39)54(40)46)64(44-21-9-36(32-62)10-22-44)56-48(28-42(58)30-50(56)60)38-13-5-34(2)6-14-38/h3-30H,1-2H3 |
| InChIKey | ONFKORQCGCKHAY-UHFFFAOYSA-N |
| XLogP | 15.77 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.91 |
| LogP ≤ 5 | 15.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|