C9H7NO — CID 88987558
5-isocyanato-6-methylcyclohepta-1,2,4,6-tetraene (PubChem CID 88987558) has the molecular formula C9H7NO and a molecular weight of 145.16 g/mol. Its IUPAC name is 5-isocyanato-6-methylcyclohepta-1,2,4,6-tetraene.
| Compound Name | 5-isocyanato-6-methylcyclohepta-1,2,4,6-tetraene |
|---|---|
| PubChem CID | 88987558 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 5-isocyanato-6-methylcyclohepta-1,2,4,6-tetraene |
| SMILES | CC1=CC=C=CC=C1N=C=O |
| InChI | InChI=1S/C9H7NO/c1-8-5-3-2-4-6-9(8)10-7-11/h3-6H,1H3 |
| InChIKey | ZWQYGJQKRJHODP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|