C10H11NO — CID 91127501
3-isocyanato-7,7-dimethylcyclohepta-1,3,5-triene (PubChem CID 91127501) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 3-isocyanato-7,7-dimethylcyclohepta-1,3,5-triene.
| Compound Name | 3-isocyanato-7,7-dimethylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 91127501 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 3-isocyanato-7,7-dimethylcyclohepta-1,3,5-triene |
| SMILES | CC1(C)C=CC=C(N=C=O)C=C1 |
| InChI | InChI=1S/C10H11NO/c1-10(2)6-3-4-9(5-7-10)11-8-12/h3-7H,1-2H3 |
| InChIKey | ZTMADICVCIKJEI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|