C24H25N3O3 — CID 8898758
N-(2-methoxyphenyl)-4-[[2-[[(1S)-1-phenylethyl]amino]acetyl]amino]benzamide (PubChem CID 8898758) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4-[[2-[[(1S)-1-phenylethyl]amino]acetyl]amino]benzamide.
| Compound Name | N-(2-methoxyphenyl)-4-[[2-[[(1S)-1-phenylethyl]amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 8898758 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-(2-methoxyphenyl)-4-[[2-[[(1S)-1-phenylethyl]amino]acetyl]amino]benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)CN[C@@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25N3O3/c1-17(18-8-4-3-5-9-18)25-16-23(28)26-20-14-12-19(13-15-20)24(29)27-21-10-6-7-11-22(21)30-2/h3-15,17,25H,16H2,1-2H3,(H,26,28)(H,27,29)/t17-/m0/s1 |
| InChIKey | HUTOCYMEHFLQOA-KRWDZBQOSA-N |
| XLogP | 4.24 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |