C21H14N2O2S4 — CID 88989215
(5Z)-5-[(4-methylphenyl)methylidene]-3-[3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 88989215) has the molecular formula C21H14N2O2S4 and a molecular weight of 454.62 g/mol. Its IUPAC name is (5Z)-5-[(4-methylphenyl)methylidene]-3-[3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-methylphenyl)methylidene]-3-[3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 88989215 |
| Molecular Formula | C21H14N2O2S4 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 453.99 |
| IUPAC Name | (5Z)-5-[(4-methylphenyl)methylidene]-3-[3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/C=C2\SC(=S)N(c3cccc(/C=C4\SC(=S)NC4=O)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H14N2O2S4/c1-12-5-7-13(8-6-12)10-17-19(25)23(21(27)29-17)15-4-2-3-14(9-15)11-16-18(24)22-20(26)28-16/h2-11H,1H3,(H,22,24,26)/b16-11-,17-10- |
| InChIKey | DJKGQWXMORHEOT-ZTLHOUMVSA-N |
| XLogP | 4.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|