C24H28ClN5O4S — CID 88990591
N-(3-chloropropyl)-4-[4-(quinolin-8-ylsulfonylamino)cyclohexa-1,5-diene-1-carbonyl]piperazine-1-carboxamide (PubChem CID 88990591) has the molecular formula C24H28ClN5O4S and a molecular weight of 518.04 g/mol. Its IUPAC name is N-(3-chloropropyl)-4-[4-(quinolin-8-ylsulfonylamino)cyclohexa-1,5-diene-1-carbonyl]piperazine-1-carboxamide.
| Compound Name | N-(3-chloropropyl)-4-[4-(quinolin-8-ylsulfonylamino)cyclohexa-1,5-diene-1-carbonyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 88990591 |
| Molecular Formula | C24H28ClN5O4S |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | N-(3-chloropropyl)-4-[4-(quinolin-8-ylsulfonylamino)cyclohexa-1,5-diene-1-carbonyl]piperazine-1-carboxamide |
| SMILES | O=C(NCCCCl)N1CCN(C(=O)C2=CCC(NS(=O)(=O)c3cccc4cccnc34)C=C2)CC1 |
| InChI | InChI=1S/C24H28ClN5O4S/c25-11-3-13-27-24(32)30-16-14-29(15-17-30)23(31)19-7-9-20(10-8-19)28-35(33,34)21-6-1-4-18-5-2-12-26-22(18)21/h1-2,4-9,12,20,28H,3,10-11,13-17H2,(H,27,32) |
| InChIKey | RBZBGMNDEVQQCB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|