C36H39F2N3O4Si — CID 88993087
(4S)-3-[(2R,5S)-2-[(S)-(4-aminophenyl)-(4-fluoroanilino)methyl]-5-(4-fluorophenyl)-5-trimethylsilyloxypentanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 88993087) has the molecular formula C36H39F2N3O4Si and a molecular weight of 643.81 g/mol. Its IUPAC name is (4S)-3-[(2R,5S)-2-[(S)-(4-aminophenyl)-(4-fluoroanilino)methyl]-5-(4-fluorophenyl)-5-trimethylsilyloxypentanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2R,5S)-2-[(S)-(4-aminophenyl)-(4-fluoroanilino)methyl]-5-(4-fluorophenyl)-5-trimethylsilyloxypentanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 88993087 |
| Molecular Formula | C36H39F2N3O4Si |
| Molecular Weight | 643.81 g/mol |
| Exact Mass | 643.27 |
| IUPAC Name | (4S)-3-[(2R,5S)-2-[(S)-(4-aminophenyl)-(4-fluoroanilino)methyl]-5-(4-fluorophenyl)-5-trimethylsilyloxypentanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[Si](C)(C)O[C@@H](CC[C@@H](C(=O)N1C(=O)OC[C@@H]1c1ccccc1)[C@H](Nc1ccc(F)cc1)c1ccc(N)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C36H39F2N3O4Si/c1-46(2,3)45-33(25-9-13-27(37)14-10-25)22-21-31(35(42)41-32(23-44-36(41)43)24-7-5-4-6-8-24)34(26-11-17-29(39)18-12-26)40-30-19-15-28(38)16-20-30/h4-20,31-34,40H,21-23,39H2,1-3H3/t31-,32-,33+,34-/m1/s1 |
| InChIKey | ZHSVMGPMWQDRJX-YVEASBDZSA-N |
| XLogP | 8.41 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.81 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|