C40H44N4O7S — CID 88993176
2-[2-[[[2-(butylamino)acetyl]amino]methyl]-4-[[4-(cyclohexylamino)-9,10-dioxoanthracen-1-yl]amino]phenoxy]-5-methylbenzenesulfonic acid (PubChem CID 88993176) has the molecular formula C40H44N4O7S and a molecular weight of 724.88 g/mol. Its IUPAC name is 2-[2-[[[2-(butylamino)acetyl]amino]methyl]-4-[[4-(cyclohexylamino)-9,10-dioxoanthracen-1-yl]amino]phenoxy]-5-methylbenzenesulfonic acid.
| Compound Name | 2-[2-[[[2-(butylamino)acetyl]amino]methyl]-4-[[4-(cyclohexylamino)-9,10-dioxoanthracen-1-yl]amino]phenoxy]-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 88993176 |
| Molecular Formula | C40H44N4O7S |
| Molecular Weight | 724.88 g/mol |
| Exact Mass | 724.29 |
| IUPAC Name | 2-[2-[[[2-(butylamino)acetyl]amino]methyl]-4-[[4-(cyclohexylamino)-9,10-dioxoanthracen-1-yl]amino]phenoxy]-5-methylbenzenesulfonic acid |
| SMILES | CCCCNCC(=O)NCc1cc(Nc2ccc(NC3CCCCC3)c3c2C(=O)c2ccccc2C3=O)ccc1Oc1ccc(C)cc1S(=O)(=O)O |
| InChI | InChI=1S/C40H44N4O7S/c1-3-4-20-41-24-36(45)42-23-26-22-28(15-19-33(26)51-34-18-14-25(2)21-35(34)52(48,49)50)44-32-17-16-31(43-27-10-6-5-7-11-27)37-38(32)40(47)30-13-9-8-12-29(30)39(37)46/h8-9,12-19,21-22,27,41,43-44H,3-7,10-11,20,23-24H2,1-2H3,(H,42,45)(H,48,49,50) |
| InChIKey | LRFAXWPRSJNOIR-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.88 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|