C15H12ClN7O — CID 88993278
1-(6-chloro-3-pyridinyl)-3-(4-methyl-6-pyridin-2-yl-1,3,5-triazin-2-yl)urea (PubChem CID 88993278) has the molecular formula C15H12ClN7O and a molecular weight of 341.76 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)-3-(4-methyl-6-pyridin-2-yl-1,3,5-triazin-2-yl)urea.
| Compound Name | 1-(6-chloro-3-pyridinyl)-3-(4-methyl-6-pyridin-2-yl-1,3,5-triazin-2-yl)urea |
|---|---|
| PubChem CID | 88993278 |
| Molecular Formula | C15H12ClN7O |
| Molecular Weight | 341.76 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)-3-(4-methyl-6-pyridin-2-yl-1,3,5-triazin-2-yl)urea |
| SMILES | Cc1nc(NC(=O)Nc2ccc(Cl)nc2)nc(-c2ccccn2)n1 |
| InChI | InChI=1S/C15H12ClN7O/c1-9-19-13(11-4-2-3-7-17-11)22-14(20-9)23-15(24)21-10-5-6-12(16)18-8-10/h2-8H,1H3,(H2,19,20,21,22,23,24) |
| InChIKey | SVNVONNWQLNYSO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.76 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|