C7H13NO5S — CID 88995563
(2R,5Z)-5-hydroxyimino-2-methyl-2-methylsulfonylpentanoic acid (PubChem CID 88995563) has the molecular formula C7H13NO5S and a molecular weight of 223.25 g/mol. Its IUPAC name is (2R,5Z)-5-hydroxyimino-2-methyl-2-methylsulfonylpentanoic acid.
| Compound Name | (2R,5Z)-5-hydroxyimino-2-methyl-2-methylsulfonylpentanoic acid |
|---|---|
| PubChem CID | 88995563 |
| Molecular Formula | C7H13NO5S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | (2R,5Z)-5-hydroxyimino-2-methyl-2-methylsulfonylpentanoic acid |
| SMILES | C[C@@](CC/C=N\O)(C(=O)O)S(C)(=O)=O |
| InChI | InChI=1S/C7H13NO5S/c1-7(6(9)10,14(2,12)13)4-3-5-8-11/h5,11H,3-4H2,1-2H3,(H,9,10)/b8-5-/t7-/m1/s1 |
| InChIKey | XMMVPQQTKUCDFH-BESBCXERSA-N |
| XLogP | 0.11 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|